CAS 848589-36-6 appears in our catalog under these names: N-(3-Aminopropyl)-4-methyl-2-nitroaniline hydrochloride, 95%, N1–(4–Methyl–2–nitrophenyl)propane–1,3–diamine hydrochloride, N-(3-Aminopropyl)-4-methyl-2-nitroaniline hydrochloride. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 1g, 100mg, 250mg, 50mg, 0,5g.
N'-(4-methyl-2-nitrophenyl)propane-1,3-diamine;hydrochloride (CAS 848589-36-6) is a chemical compound with the molecular formula C10H16ClN3O2 and a molecular weight of 245.70 g/mol. IUPAC name: N'-(4-methyl-2-nitrophenyl)propane-1,3-diamine;hydrochloride. InChIKey: MIIBYEUDNUFALI-UHFFFAOYSA-N.
| Molecular formula | C10H16ClN3O2 |
|---|---|
| Molecular weight | 245.70 g/mol |
| IUPAC name | N'-(4-methyl-2-nitrophenyl)propane-1,3-diamine;hydrochloride |
| InChIKey | MIIBYEUDNUFALI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NCCCN)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)