CAS 848622-58-2 is the registry number for 2-(2,4-dichlorophenoxy)-N-(6-methoxy(3-pyridyl))ethanamide. Offered by: Biosynth. Available pack sizes: 500mg, 1000mg, 2000mg, 5000mg.
2-(2,4-dichlorophenoxy)-N-(6-methoxy-3-pyridinyl)acetamide (CAS 848622-58-2) is a chemical compound with the molecular formula C14H12Cl2N2O3 and a molecular weight of 327.2 g/mol. IUPAC name: 2-(2,4-dichlorophenoxy)-N-(6-methoxy-3-pyridinyl)acetamide. InChIKey: QUPRBIYVEMIJPQ-UHFFFAOYSA-N.
| Molecular formula | C14H12Cl2N2O3 |
|---|---|
| Molecular weight | 327.2 g/mol |
| IUPAC name | 2-(2,4-dichlorophenoxy)-N-(6-methoxy-3-pyridinyl)acetamide |
| InChIKey | QUPRBIYVEMIJPQ-UHFFFAOYSA-N |
| SMILES | COC1=NC=C(C=C1)NC(=O)COC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)