CAS 848641-69-0 appears in our catalog under these names: 1-Ethyl-3-methylimidazolium diethyl phosphate, 96%, 1–ethyl–3–methylimidazolium diethylphosphate, 1-Ethyl-3-methylimidazolium diethyl phosphate, 98% , 1-Ethyl-3-methylimidazolium Diethyl Phosphate, >96.0%(HPLC)(T), 1-Ethyl-3-methylimidazolium diethyl phosphate 96%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 1g, 25g, 100g, 5g, 500g, 50g, 10g, 1KG.
Diethyl phosphate;1-ethyl-3-methylimidazol-3-ium (CAS 848641-69-0) is a chemical compound with the molecular formula C10H21N2O4P and a molecular weight of 264.26 g/mol. IUPAC name: diethyl phosphate;1-ethyl-3-methylimidazol-3-ium. InChIKey: HQWOEDCLDNFWEV-UHFFFAOYSA-M.
| Molecular formula | C10H21N2O4P |
|---|---|
| Molecular weight | 264.26 g/mol |
| IUPAC name | diethyl phosphate;1-ethyl-3-methylimidazol-3-ium |
| InChIKey | HQWOEDCLDNFWEV-UHFFFAOYSA-M |
| SMILES | CCN1C=C[N+](=C1)C.CCOP(=O)([O-])OCC |
Computed by PubChem (NCBI)