CAS 848694-11-1 is the registry number for 4-Bromo-2,3,5-trimethylpyridin-1-ium-1-olate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-bromo-2,3,5-trimethyl-1-oxidopyridin-1-ium (CAS 848694-11-1) is a chemical compound with the molecular formula C8H10BrNO and a molecular weight of 216.07 g/mol. IUPAC name: 4-bromo-2,3,5-trimethyl-1-oxidopyridin-1-ium. InChIKey: XJTFVTIYKKOOCN-UHFFFAOYSA-N.
| Molecular formula | C8H10BrNO |
|---|---|
| Molecular weight | 216.07 g/mol |
| IUPAC name | 4-bromo-2,3,5-trimethyl-1-oxidopyridin-1-ium |
| InChIKey | XJTFVTIYKKOOCN-UHFFFAOYSA-N |
| SMILES | CC1=C[N+](=C(C(=C1Br)C)C)[O-] |
Computed by PubChem (NCBI)