CAS 84870-65-5 is the registry number for Disperse blue 366. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[[4-(diethylamino)-2-methylphenyl]diazenyl]-5-nitrobenzene-1,3-dicarbonitrile (CAS 84870-65-5) is a chemical compound with the molecular formula C19H18N6O2 and a molecular weight of 362.4 g/mol. IUPAC name: 2-[[4-(diethylamino)-2-methylphenyl]diazenyl]-5-nitrobenzene-1,3-dicarbonitrile. InChIKey: HCOYTIPJLYJCDR-UHFFFAOYSA-N.
| Molecular formula | C19H18N6O2 |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | 2-[[4-(diethylamino)-2-methylphenyl]diazenyl]-5-nitrobenzene-1,3-dicarbonitrile |
| InChIKey | HCOYTIPJLYJCDR-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC(=C(C=C1)N=NC2=C(C=C(C=C2C#N)[N+](=O)[O-])C#N)C |
Computed by PubChem (NCBI)