CAS 848750-68-5 is the registry number for 4-Ipomeanol-d6. Offered by: TRC. Available pack sizes: 25mg.
3,3,4,5,5,5-hexadeuterio-1-(furan-3-yl)-4-hydroxypentan-1-one (CAS 848750-68-5) is a chemical compound with the molecular formula C9H12O3 and a molecular weight of 174.23 g/mol. IUPAC name: 3,3,4,5,5,5-hexadeuterio-1-(furan-3-yl)-4-hydroxypentan-1-one. InChIKey: RJYQLMILDVERHH-DTHBTZQSSA-N.
| Molecular formula | C9H12O3 |
|---|---|
| Molecular weight | 174.23 g/mol |
| IUPAC name | 3,3,4,5,5,5-hexadeuterio-1-(furan-3-yl)-4-hydroxypentan-1-one |
| InChIKey | RJYQLMILDVERHH-DTHBTZQSSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])CC(=O)C1=COC=C1)O |
Computed by PubChem (NCBI)