CAS 84888-34-6 appears in our catalog under these names: H-Cys(Fm)-OH hydrochloride, 95%, S-9-Fluorenylmethyl-L-cysteine Hydrochloride. Offered by: Combi-blocks, TRC. Available pack sizes: 1g, 250mg, 5g.
(2R)-2-amino-3-(9H-fluoren-9-ylmethylsulfanyl)propanoic acid;hydrochloride (CAS 84888-34-6) is a chemical compound with the molecular formula C17H18ClNO2S and a molecular weight of 335.8 g/mol. IUPAC name: (2R)-2-amino-3-(9H-fluoren-9-ylmethylsulfanyl)propanoic acid;hydrochloride. InChIKey: JPEGSXXJPHXBPA-NTISSMGPSA-N.
| Molecular formula | C17H18ClNO2S |
|---|---|
| Molecular weight | 335.8 g/mol |
| IUPAC name | (2R)-2-amino-3-(9H-fluoren-9-ylmethylsulfanyl)propanoic acid;hydrochloride |
| InChIKey | JPEGSXXJPHXBPA-NTISSMGPSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)CSC[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)