CAS 84901-27-9 appears in our catalog under these names: Trimethyl[3-(triethoxysilyl)propyl]ammonium chloride, 95%, N,N,N-Trimethyl-3-(triethoxysilyl)propan-1-aminium chloride, 98%, N,N,N–Trimethyl–3–(triethoxysilyl)propan–1–aminium chloride, Trimethyl[3-(triethoxysilyl)propyl]ammonium Chloride, >98.0%(T), N,N,N-Trimethyl-3-(triethoxysilyl)propan-1-aminium chloride, ≥98%, ≥98%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 1g, 10g, 5g, 25g, 250mg, 200mg, Get quote.
Trimethyl(3-triethoxysilylpropyl)azanium chloride (CAS 84901-27-9) is a chemical compound with the molecular formula C12H30ClNO3Si and a molecular weight of 299.91 g/mol. IUPAC name: trimethyl(3-triethoxysilylpropyl)azanium chloride. InChIKey: JMCRETWEZLOFQT-UHFFFAOYSA-M.
| Molecular formula | C12H30ClNO3Si |
|---|---|
| Molecular weight | 299.91 g/mol |
| IUPAC name | trimethyl(3-triethoxysilylpropyl)azanium chloride |
| InChIKey | JMCRETWEZLOFQT-UHFFFAOYSA-M |
| SMILES | CCO[Si](CCC[N+](C)(C)C)(OCC)OCC.[Cl-] |
Computed by PubChem (NCBI)