Products 849035-87-6

CAS 849035-87-6 is the registry number for 5-Fluoro-7-(methylsulfonyl)-1H-indole-2-carboxylic acid, 95%. Offered by: Fluorochem. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

5-fluoro-7-methylsulfonyl-1H-indole-2-carboxylic acid (CAS 849035-87-6) is a chemical compound with the molecular formula C10H8FNO4S and a molecular weight of 257.24 g/mol. IUPAC name: 5-fluoro-7-methylsulfonyl-1H-indole-2-carboxylic acid. InChIKey: WNCWFIMFLBFIRS-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8FNO4S
Molecular weight257.24 g/mol
IUPAC name5-fluoro-7-methylsulfonyl-1H-indole-2-carboxylic acid
InChIKeyWNCWFIMFLBFIRS-UHFFFAOYSA-N
SMILESCS(=O)(=O)C1=C2C(=CC(=C1)F)C=C(N2)C(=O)O

Computed by PubChem (NCBI)