CAS 849035-87-6 is the registry number for 5-Fluoro-7-(methylsulfonyl)-1H-indole-2-carboxylic acid, 95%. Offered by: Fluorochem. Available pack sizes: 1g.
5-fluoro-7-methylsulfonyl-1H-indole-2-carboxylic acid (CAS 849035-87-6) is a chemical compound with the molecular formula C10H8FNO4S and a molecular weight of 257.24 g/mol. IUPAC name: 5-fluoro-7-methylsulfonyl-1H-indole-2-carboxylic acid. InChIKey: WNCWFIMFLBFIRS-UHFFFAOYSA-N.
| Molecular formula | C10H8FNO4S |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | 5-fluoro-7-methylsulfonyl-1H-indole-2-carboxylic acid |
| InChIKey | WNCWFIMFLBFIRS-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C2C(=CC(=C1)F)C=C(N2)C(=O)O |
Computed by PubChem (NCBI)