CAS 849052-24-0 appears in our catalog under these names: 3-Bromo-2-(3'-methoxybenzyloxy)phenylboronic acid, 95%, (3-Bromo-2-((3-methoxybenzyl)oxy)phenyl)boronic acid 95%, 3-Bromo-2-(3'-methoxybenzyloxy)phenylboronic acid, 95%, 95%, (3-Bromo-2-((3-methoxybenzyl)oxy)phenyl)boronic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
[3-bromo-2-[(3-methoxyphenyl)methoxy]phenyl]boronic acid (CAS 849052-24-0) is a chemical compound with the molecular formula C14H14BBrO4 and a molecular weight of 336.98 g/mol. IUPAC name: [3-bromo-2-[(3-methoxyphenyl)methoxy]phenyl]boronic acid. InChIKey: JNPYQBOHAURAQI-UHFFFAOYSA-N.
| Molecular formula | C14H14BBrO4 |
|---|---|
| Molecular weight | 336.98 g/mol |
| IUPAC name | [3-bromo-2-[(3-methoxyphenyl)methoxy]phenyl]boronic acid |
| InChIKey | JNPYQBOHAURAQI-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)Br)OCC2=CC(=CC=C2)OC)(O)O |
Computed by PubChem (NCBI)