CAS 849062-01-7 appears in our catalog under these names: 2,6-Difluoro-3-(3',5'-dimethoxybenzyloxy)phenylboronic acid, 95%, (3-((3,5-Dimethoxybenzyl)oxy)-2,6-difluorophenyl)boronic acid 98%, B-[3-[(3,5-Dimethoxyphenyl)methoxy]-2,6-difluorophenyl]boronic acid, 98%, 98%, (3-((3,5-Dimethoxybenzyl)oxy)-2,6-difluorophenyl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
[3-[(3,5-dimethoxyphenyl)methoxy]-2,6-difluorophenyl]boronic acid (CAS 849062-01-7) is a chemical compound with the molecular formula C15H15BF2O5 and a molecular weight of 324.09 g/mol. IUPAC name: [3-[(3,5-dimethoxyphenyl)methoxy]-2,6-difluorophenyl]boronic acid. InChIKey: CKMBETHVNGWKIN-UHFFFAOYSA-N.
| Molecular formula | C15H15BF2O5 |
|---|---|
| Molecular weight | 324.09 g/mol |
| IUPAC name | [3-[(3,5-dimethoxyphenyl)methoxy]-2,6-difluorophenyl]boronic acid |
| InChIKey | CKMBETHVNGWKIN-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)OCC2=CC(=CC(=C2)OC)OC)F)(O)O |
Computed by PubChem (NCBI)