Products 849062-02-8
CAS 849062-02-8 appears in our catalog under these names: 5–Bromo–3–ethoxyphenylboronic acid, 5-Bromo-3-ethoxyphenylboronic acid, 95%, 95%, (3-Bromo-5-ethoxyphenyl)boronic acid, 98%, (3-Bromo-5-ethoxyphenyl)boronic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g.
(3-bromo-5-ethoxyphenyl)boronic acid (CAS 849062-02-8) is a chemical compound with the molecular formula C8H10BBrO3 and a molecular weight of 244.88 g/mol. IUPAC name: (3-bromo-5-ethoxyphenyl)boronic acid. InChIKey: FCUBWEOZVDXVHL-UHFFFAOYSA-N.
| Molecular formula | C8H10BBrO3 |
|---|---|
| Molecular weight | 244.88 g/mol |
| IUPAC name | (3-bromo-5-ethoxyphenyl)boronic acid |
| InChIKey | FCUBWEOZVDXVHL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Br)OCC)(O)O |
Computed by PubChem (NCBI)