CAS 849062-23-3 is the registry number for 3-Bromo-5-methyl-2-(3'-methoxybenzyloxy)phenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[3-bromo-2-[(3-methoxyphenyl)methoxy]-5-methylphenyl]boronic acid (CAS 849062-23-3) is a chemical compound with the molecular formula C15H16BBrO4 and a molecular weight of 351.00 g/mol. IUPAC name: [3-bromo-2-[(3-methoxyphenyl)methoxy]-5-methylphenyl]boronic acid. InChIKey: KTEDZUFTBUUJLG-UHFFFAOYSA-N.
| Molecular formula | C15H16BBrO4 |
|---|---|
| Molecular weight | 351.00 g/mol |
| IUPAC name | [3-bromo-2-[(3-methoxyphenyl)methoxy]-5-methylphenyl]boronic acid |
| InChIKey | KTEDZUFTBUUJLG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1OCC2=CC(=CC=C2)OC)Br)C)(O)O |
Computed by PubChem (NCBI)