CAS 849062-24-4 appears in our catalog under these names: 3-Chloro-4-(3',5'-dimethoxybenzyloxy)phenylboronic acid, 95%, 3-Chloro-4-(3',5'-dimethoxybenzyloxy)phenylboronic acid, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g.
[3-chloro-4-[(3,5-dimethoxyphenyl)methoxy]phenyl]boronic acid (CAS 849062-24-4) is a chemical compound with the molecular formula C15H16BClO5 and a molecular weight of 322.5 g/mol. IUPAC name: [3-chloro-4-[(3,5-dimethoxyphenyl)methoxy]phenyl]boronic acid. InChIKey: ALGYTGHGIFYXPT-UHFFFAOYSA-N.
| Molecular formula | C15H16BClO5 |
|---|---|
| Molecular weight | 322.5 g/mol |
| IUPAC name | [3-chloro-4-[(3,5-dimethoxyphenyl)methoxy]phenyl]boronic acid |
| InChIKey | ALGYTGHGIFYXPT-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OCC2=CC(=CC(=C2)OC)OC)Cl)(O)O |
Computed by PubChem (NCBI)