CAS 849062-25-5 is the registry number for 3-Chloro-4-(3'-bromobenzyloxy)phenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[4-[(3-bromophenyl)methoxy]-3-chlorophenyl]boronic acid (CAS 849062-25-5) is a chemical compound with the molecular formula C13H11BBrClO3 and a molecular weight of 341.39 g/mol. IUPAC name: [4-[(3-bromophenyl)methoxy]-3-chlorophenyl]boronic acid. InChIKey: HKBRUUCYKMOURT-UHFFFAOYSA-N.
| Molecular formula | C13H11BBrClO3 |
|---|---|
| Molecular weight | 341.39 g/mol |
| IUPAC name | [4-[(3-bromophenyl)methoxy]-3-chlorophenyl]boronic acid |
| InChIKey | HKBRUUCYKMOURT-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OCC2=CC(=CC=C2)Br)Cl)(O)O |
Computed by PubChem (NCBI)