CAS 849062-27-7 is the registry number for 3-Bromo-2-(3'-bromobenzyloxy)phenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[3-bromo-2-[(3-bromophenyl)methoxy]phenyl]boronic acid (CAS 849062-27-7) is a chemical compound with the molecular formula C13H11BBr2O3 and a molecular weight of 385.85 g/mol. IUPAC name: [3-bromo-2-[(3-bromophenyl)methoxy]phenyl]boronic acid. InChIKey: JWOHGYXQGYSJMX-UHFFFAOYSA-N.
| Molecular formula | C13H11BBr2O3 |
|---|---|
| Molecular weight | 385.85 g/mol |
| IUPAC name | [3-bromo-2-[(3-bromophenyl)methoxy]phenyl]boronic acid |
| InChIKey | JWOHGYXQGYSJMX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)Br)OCC2=CC(=CC=C2)Br)(O)O |
Computed by PubChem (NCBI)