CAS 849062-40-4 appears in our catalog under these names: 3-Bromo-2-(3'-fluorobenzyloxy)-5-methylphenylboronic acid, 95%, (3-Bromo-2-((3-fluorobenzyl)oxy)-5-methylphenyl)boronic acid 95%, 3-Bromo-2-(3'-fluorobenzyloxy)-5-methylphenylboronic acid, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
[3-bromo-2-[(3-fluorophenyl)methoxy]-5-methylphenyl]boronic acid (CAS 849062-40-4) is a chemical compound with the molecular formula C14H13BBrFO3 and a molecular weight of 338.97 g/mol. IUPAC name: [3-bromo-2-[(3-fluorophenyl)methoxy]-5-methylphenyl]boronic acid. InChIKey: NOUJKVHYFUPYNQ-UHFFFAOYSA-N.
| Molecular formula | C14H13BBrFO3 |
|---|---|
| Molecular weight | 338.97 g/mol |
| IUPAC name | [3-bromo-2-[(3-fluorophenyl)methoxy]-5-methylphenyl]boronic acid |
| InChIKey | NOUJKVHYFUPYNQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1OCC2=CC(=CC=C2)F)Br)C)(O)O |
Computed by PubChem (NCBI)