CAS 849206-43-5 appears in our catalog under these names: Olmesartan lactone impurity, Olmesartan Medoxomil Impurity B(EP), Olmesartan Medoxomil EP Impurity B, Olmesartan Lactone Impurity, >95% (HPLC), 6,6-Dimethyl-2-propyl-3-((2'-(1H-tetrazol-5-yl)biphenyl-4-yl)methyl)-3,6-dihydro-4H-furo(3,4-d)imidazol-4-one. Offered by: GLPBio, Chemat Brand, TRC, Mikromol, TargetMol. Available pack sizes: 5mg, on request, 25mg, 50mg, 4x25mg, 100mg, 10mg, 500mg.
6,6-dimethyl-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]furo[3,4-d]imidazol-4-one (CAS 849206-43-5) is a chemical compound with the molecular formula C24H24N6O2 and a molecular weight of 428.5 g/mol. IUPAC name: 6,6-dimethyl-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]furo[3,4-d]imidazol-4-one. InChIKey: JUQNVWFXORBZQJ-UHFFFAOYSA-N.
| Molecular formula | C24H24N6O2 |
|---|---|
| Molecular weight | 428.5 g/mol |
| IUPAC name | 6,6-dimethyl-2-propyl-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]furo[3,4-d]imidazol-4-one |
| InChIKey | JUQNVWFXORBZQJ-UHFFFAOYSA-N |
| SMILES | CCCC1=NC2=C(N1CC3=CC=C(C=C3)C4=CC=CC=C4C5=NNN=N5)C(=O)OC2(C)C |
Computed by PubChem (NCBI)