CAS 849217-77-2 appears in our catalog under these names: Cabozantinib Impurity F(Cabozantinib M-acid Impurity), Cabozantinib Des-O-fluoroaniline, >95% (HPLC), 1-(4-(6,7-Dimethoxy-quinolin-4-yloxy)-phenylcarbamoyl)-cyclopropanecarboxylic acid, Cabozantinib Metabolite M7, Cabozantinib Impurity 8 HCl. Offered by: Chemat Brand, TRC, Biosynth, HPC Standards. Available pack sizes: on request, 100mg, 10mg, 25mg, 1x25mg.
1-[[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamoyl]cyclopropane-1-carboxylic acid (CAS 849217-77-2) is a chemical compound with the molecular formula C22H20N2O6 and a molecular weight of 408.4 g/mol. IUPAC name: 1-[[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamoyl]cyclopropane-1-carboxylic acid. InChIKey: HXGYPQKHBCZWKO-UHFFFAOYSA-N.
| Molecular formula | C22H20N2O6 |
|---|---|
| Molecular weight | 408.4 g/mol |
| IUPAC name | 1-[[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamoyl]cyclopropane-1-carboxylic acid |
| InChIKey | HXGYPQKHBCZWKO-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=CN=C2C=C1OC)OC3=CC=C(C=C3)NC(=O)C4(CC4)C(=O)O |
Computed by PubChem (NCBI)