Products 849233-98-3
CAS 849233-98-3 is the registry number for HDAC1-IN-10. Offered by: MedChemExpress. Available pack sizes: Get quote.
Pyridin-3-ylmethyl N-[[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]methyl]carbamate (CAS 849233-98-3) is a chemical compound with the molecular formula C25H22N4O3S and a molecular weight of 458.5 g/mol. IUPAC name: pyridin-3-ylmethyl N-[[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]methyl]carbamate. InChIKey: ASIJNKHQTPQFCQ-UHFFFAOYSA-N.
| Molecular formula | C25H22N4O3S |
|---|---|
| Molecular weight | 458.5 g/mol |
| IUPAC name | pyridin-3-ylmethyl N-[[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]methyl]carbamate |
| InChIKey | ASIJNKHQTPQFCQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)COC(=O)NCC2=CC=C(C=C2)C(=O)NC3=C(C=CC(=C3)C4=CC=CS4)N |
Computed by PubChem (NCBI)