CAS 849438-95-5 is the registry number for N-(4-Bromo-2,6-diisopropylphenyl)-1,1-diphenylmethanimine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N-[4-bromo-2,6-di(propan-2-yl)phenyl]-1,1-diphenylmethanimine (CAS 849438-95-5) is a chemical compound with the molecular formula C25H26BrN and a molecular weight of 420.4 g/mol. IUPAC name: N-[4-bromo-2,6-di(propan-2-yl)phenyl]-1,1-diphenylmethanimine. InChIKey: SVQNTLXITUGLRN-UHFFFAOYSA-N.
| Molecular formula | C25H26BrN |
|---|---|
| Molecular weight | 420.4 g/mol |
| IUPAC name | N-[4-bromo-2,6-di(propan-2-yl)phenyl]-1,1-diphenylmethanimine |
| InChIKey | SVQNTLXITUGLRN-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1N=C(C2=CC=CC=C2)C3=CC=CC=C3)C(C)C)Br |
Computed by PubChem (NCBI)