CAS 84958-45-2 appears in our catalog under these names: Diflunisal Phosphate, >95% (HPLC), Diflunisal phosphate. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 500mg, 50mg.
5-(2,4-difluorophenyl)-2-phosphonooxybenzoic acid (CAS 84958-45-2) is a chemical compound with the molecular formula C13H9F2O6P and a molecular weight of 330.18 g/mol. IUPAC name: 5-(2,4-difluorophenyl)-2-phosphonooxybenzoic acid. InChIKey: PBINCWMWAIMYCR-UHFFFAOYSA-N.
| Molecular formula | C13H9F2O6P |
|---|---|
| Molecular weight | 330.18 g/mol |
| IUPAC name | 5-(2,4-difluorophenyl)-2-phosphonooxybenzoic acid |
| InChIKey | PBINCWMWAIMYCR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=C(C=C(C=C2)F)F)C(=O)O)OP(=O)(O)O |
Computed by PubChem (NCBI)