CAS 84963-38-2 appears in our catalog under these names: Diazoxide Impurity 1 Sodium Salt, Diazoxide Impurity 4. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Sodium 2-acetamido-5-chlorobenzenesulfonate (CAS 84963-38-2) is a chemical compound with the molecular formula C8H7ClNNaO4S and a molecular weight of 271.65 g/mol. IUPAC name: sodium 2-acetamido-5-chlorobenzenesulfonate. InChIKey: GFUFZPFKKASMNJ-UHFFFAOYSA-M.
| Molecular formula | C8H7ClNNaO4S |
|---|---|
| Molecular weight | 271.65 g/mol |
| IUPAC name | sodium 2-acetamido-5-chlorobenzenesulfonate |
| InChIKey | GFUFZPFKKASMNJ-UHFFFAOYSA-M |
| SMILES | CC(=O)NC1=C(C=C(C=C1)Cl)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)