CAS 849630-44-0 is the registry number for 6-Bromo-1,8-diethyl-1,3,4,9-tetrahydropyrano(3,4-b)indole-1-ethanol. Offered by: TRC. Available pack sizes: 500mg.
2-(6-bromo-1,8-diethyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)ethanol (CAS 849630-44-0) is a chemical compound with the molecular formula C17H22BrNO2 and a molecular weight of 352.3 g/mol. IUPAC name: 2-(6-bromo-1,8-diethyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)ethanol. InChIKey: FEDANGZXMSYBKD-UHFFFAOYSA-N.
| Molecular formula | C17H22BrNO2 |
|---|---|
| Molecular weight | 352.3 g/mol |
| IUPAC name | 2-(6-bromo-1,8-diethyl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)ethanol |
| InChIKey | FEDANGZXMSYBKD-UHFFFAOYSA-N |
| SMILES | CCC1=C2C(=CC(=C1)Br)C3=C(N2)C(OCC3)(CC)CCO |
Computed by PubChem (NCBI)