Products 849701-73-1
CAS 849701-73-1 is the registry number for Ethyl 2-(1-benzhydrylazetidin-3-ylidene)-2-chloroacetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(1-benzhydrylazetidin-3-ylidene)-2-chloroacetate (CAS 849701-73-1) is a chemical compound with the molecular formula C20H20ClNO2 and a molecular weight of 341.8 g/mol. IUPAC name: ethyl 2-(1-benzhydrylazetidin-3-ylidene)-2-chloroacetate. InChIKey: JSKFYOQCCJXMMO-UHFFFAOYSA-N.
| Molecular formula | C20H20ClNO2 |
|---|---|
| Molecular weight | 341.8 g/mol |
| IUPAC name | ethyl 2-(1-benzhydrylazetidin-3-ylidene)-2-chloroacetate |
| InChIKey | JSKFYOQCCJXMMO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=C1CN(C1)C(C2=CC=CC=C2)C3=CC=CC=C3)Cl |
Computed by PubChem (NCBI)