Products 849797-79-1

CAS 849797-79-1 is the registry number for 2-Benzylimidazo[1,5-a]quinolinium hexafluorophosphate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-benzylimidazo[1,5-a]quinolin-2-ium hexafluorophosphate (CAS 849797-79-1) is a chemical compound with the molecular formula C18H15F6N2P and a molecular weight of 404.3 g/mol. IUPAC name: 2-benzylimidazo[1,5-a]quinolin-2-ium hexafluorophosphate. InChIKey: VOHJHJRDNQUECO-UHFFFAOYSA-N.

Identity
Molecular formulaC18H15F6N2P
Molecular weight404.3 g/mol
IUPAC name2-benzylimidazo[1,5-a]quinolin-2-ium hexafluorophosphate
InChIKeyVOHJHJRDNQUECO-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C[N+]2=CN3C(=C2)C=CC4=CC=CC=C43.F[P-](F)(F)(F)(F)F

Computed by PubChem (NCBI)