CAS 849797-79-1 is the registry number for 2-Benzylimidazo[1,5-a]quinolinium hexafluorophosphate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-benzylimidazo[1,5-a]quinolin-2-ium hexafluorophosphate (CAS 849797-79-1) is a chemical compound with the molecular formula C18H15F6N2P and a molecular weight of 404.3 g/mol. IUPAC name: 2-benzylimidazo[1,5-a]quinolin-2-ium hexafluorophosphate. InChIKey: VOHJHJRDNQUECO-UHFFFAOYSA-N.
| Molecular formula | C18H15F6N2P |
|---|---|
| Molecular weight | 404.3 g/mol |
| IUPAC name | 2-benzylimidazo[1,5-a]quinolin-2-ium hexafluorophosphate |
| InChIKey | VOHJHJRDNQUECO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C[N+]2=CN3C(=C2)C=CC4=CC=CC=C43.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)