CAS 849807-01-8 appears in our catalog under these names: (4-[(2-Fluorophenyl)methoxy]phenyl)methanamine, 95%, (4-((2-Fluorophenyl)methoxy)phenyl)methanamine, 95%, {4-((2-Fluorophenyl)methoxy)phenyl}methanamine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg.
[4-[(2-fluorophenyl)methoxy]phenyl]methanamine (CAS 849807-01-8) is a chemical compound with the molecular formula C14H14FNO and a molecular weight of 231.26 g/mol. IUPAC name: [4-[(2-fluorophenyl)methoxy]phenyl]methanamine. InChIKey: SUQRFOCJBJMREX-UHFFFAOYSA-N.
| Molecular formula | C14H14FNO |
|---|---|
| Molecular weight | 231.26 g/mol |
| IUPAC name | [4-[(2-fluorophenyl)methoxy]phenyl]methanamine |
| InChIKey | SUQRFOCJBJMREX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)COC2=CC=C(C=C2)CN)F |
Computed by PubChem (NCBI)