CAS 849934-85-6 appears in our catalog under these names: 6-Ethoxy-5-(trifluoromethyl)-3-pyridinyl boronic acid, 98%, (6-Ethoxy-5-(trifluoromethyl)pyridin-3-yl)boronic acid, 98%, (6–Ethoxy–5–(trifluoromethyl)pyridin–3–yl)boronic acid, (6-Ethoxy-5-(trifluoromethyl)pyridin-3-yl)boronic acid, 95%, 95%, (6-Ethoxy-5-(trifluoromethyl)pyridin-3-yl)boronic acid, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
[6-ethoxy-5-(trifluoromethyl)-3-pyridinyl]boronic acid (CAS 849934-85-6) is a chemical compound with the molecular formula C8H9BF3NO3 and a molecular weight of 234.97 g/mol. IUPAC name: [6-ethoxy-5-(trifluoromethyl)-3-pyridinyl]boronic acid. InChIKey: OFQUWRKGOGCLPI-UHFFFAOYSA-N.
| Molecular formula | C8H9BF3NO3 |
|---|---|
| Molecular weight | 234.97 g/mol |
| IUPAC name | [6-ethoxy-5-(trifluoromethyl)-3-pyridinyl]boronic acid |
| InChIKey | OFQUWRKGOGCLPI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)OCC)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)