CAS 849950-54-5 is the registry number for (R,R)-iPr-Ferrocelane, 97% 99%ee. Offered by: Ambeed. Available pack sizes: 100mg, 1g, 25g, 5g, 250mg, 10g.
Bis((2R,5R)-1-cyclopenta-1,3-dien-1-yl-2,5-di(propan-2-yl)phospholane);iron(2+) (CAS 849950-54-5) is a chemical compound with the molecular formula C30H48FeP2 and a molecular weight of 526.5 g/mol. IUPAC name: bis((2R,5R)-1-cyclopenta-1,3-dien-1-yl-2,5-di(propan-2-yl)phospholane);iron(2+). InChIKey: RNAIPFYGOQYYTF-CNFAWKLCSA-N.
| Molecular formula | C30H48FeP2 |
|---|---|
| Molecular weight | 526.5 g/mol |
| IUPAC name | bis((2R,5R)-1-cyclopenta-1,3-dien-1-yl-2,5-di(propan-2-yl)phospholane);iron(2+) |
| InChIKey | RNAIPFYGOQYYTF-CNFAWKLCSA-N |
| SMILES | CC(C)[C@H]1CC[C@@H](P1C2=CC=C[CH-]2)C(C)C.CC(C)[C@H]1CC[C@@H](P1C2=CC=C[CH-]2)C(C)C.[Fe+2] |
Computed by PubChem (NCBI)