CAS 850021-31-7 is the registry number for 3-{((4-methyl-1,3-thiazol-2-yl)sulfanyl)methyl}-1-benzofuran-2-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]-1-benzofuran-2-carboxylic acid (CAS 850021-31-7) is a chemical compound with the molecular formula C14H11NO3S2 and a molecular weight of 305.4 g/mol. IUPAC name: 3-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]-1-benzofuran-2-carboxylic acid. InChIKey: ZUIWWPHNRQACTL-UHFFFAOYSA-N.
| Molecular formula | C14H11NO3S2 |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | 3-[(4-methyl-1,3-thiazol-2-yl)sulfanylmethyl]-1-benzofuran-2-carboxylic acid |
| InChIKey | ZUIWWPHNRQACTL-UHFFFAOYSA-N |
| SMILES | CC1=CSC(=N1)SCC2=C(OC3=CC=CC=C32)C(=O)O |
Computed by PubChem (NCBI)