CAS 850021-32-8 appears in our catalog under these names: (4-[(4-Acetylamino-benzenesulfonyl)-methyl-amino]-phenoxy)-acetic acid, 95%, 2-(4-(N-Methyl4-acetamidobenzenesulfonamido)phenoxy)acetic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-[4-[(4-acetamidophenyl)sulfonyl-methylamino]phenoxy]acetic acid (CAS 850021-32-8) is a chemical compound with the molecular formula C17H18N2O6S and a molecular weight of 378.4 g/mol. IUPAC name: 2-[4-[(4-acetamidophenyl)sulfonyl-methylamino]phenoxy]acetic acid. InChIKey: GQWFRJIBZFFEJD-UHFFFAOYSA-N.
| Molecular formula | C17H18N2O6S |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | 2-[4-[(4-acetamidophenyl)sulfonyl-methylamino]phenoxy]acetic acid |
| InChIKey | GQWFRJIBZFFEJD-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)(=O)N(C)C2=CC=C(C=C2)OCC(=O)O |
Computed by PubChem (NCBI)