CAS 850090-10-7 appears in our catalog under these names: Tos-peg6-t-butyl ester, 95%, Tos–PEG5–C2–Boc, Tos-PEG6-t-Butyl ester, 95%, 95%, Tos-PEG5-C2-Boc, 97.0%, tert-Butyl 1-(tosyloxy)-3,6,9,12,15-pentaoxaoctadecan-18-oate, 97%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg, 500 mg, 250 mg, 5g.
Tert-butyl 3-[2-[2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 850090-10-7) is a chemical compound with the molecular formula C24H40O10S and a molecular weight of 520.6 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: VWGDQEZCDGHEJR-UHFFFAOYSA-N.
| Molecular formula | C24H40O10S |
|---|---|
| Molecular weight | 520.6 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | VWGDQEZCDGHEJR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOCCOCCOCCC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)