CAS 850090-16-3 is the registry number for tert–Butyl (2–(2–(2–((2,4–dinitrophenyl)amino)ethoxy)ethoxy)ethyl)carbamate. Offered by: GLPBio. Available pack sizes: 100mg, 250mg, 500mg.
Tert-butyl N-[2-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]ethyl]carbamate (CAS 850090-16-3) is a chemical compound with the molecular formula C17H26N4O8 and a molecular weight of 414.4 g/mol. IUPAC name: tert-butyl N-[2-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]ethyl]carbamate. InChIKey: LEWLTZBYVOZNDH-UHFFFAOYSA-N.
| Molecular formula | C17H26N4O8 |
|---|---|
| Molecular weight | 414.4 g/mol |
| IUPAC name | tert-butyl N-[2-[2-[2-(2,4-dinitroanilino)ethoxy]ethoxy]ethyl]carbamate |
| InChIKey | LEWLTZBYVOZNDH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCNC1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)