CAS 85019-61-0 is the registry number for 3-Bromo-2,4,5,6-tetrafluoro-phenol. Offered by: TRC. Available pack sizes: 1g.
3-bromo-2,4,5,6-tetrafluorophenol (CAS 85019-61-0) is a chemical compound with the molecular formula C6HBrF4O and a molecular weight of 244.97 g/mol. IUPAC name: 3-bromo-2,4,5,6-tetrafluorophenol. InChIKey: OODQJBBHTVFDCZ-UHFFFAOYSA-N.
| Molecular formula | C6HBrF4O |
|---|---|
| Molecular weight | 244.97 g/mol |
| IUPAC name | 3-bromo-2,4,5,6-tetrafluorophenol |
| InChIKey | OODQJBBHTVFDCZ-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)Br)F)F)F)O |
Computed by PubChem (NCBI)