CAS 850191-81-0 is the registry number for 7,8-Dihydro-5,10,15,20-tetraphenyl-21H,23H-porphine-7,8-diol, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5,10,15,20-tetraphenyl-2,3,22,24-tetrahydroporphyrin-2,3-diol (CAS 850191-81-0) is a chemical compound with the molecular formula C44H32N4O2 and a molecular weight of 648.7 g/mol. IUPAC name: 5,10,15,20-tetraphenyl-2,3,22,24-tetrahydroporphyrin-2,3-diol. InChIKey: CFLMAFPOJWFYLM-UHFFFAOYSA-N.
| Molecular formula | C44H32N4O2 |
|---|---|
| Molecular weight | 648.7 g/mol |
| IUPAC name | 5,10,15,20-tetraphenyl-2,3,22,24-tetrahydroporphyrin-2,3-diol |
| InChIKey | CFLMAFPOJWFYLM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3C=CC(=C(C4=NC(=C(C5=CC=C(N5)C(=C6C=CC2=N6)C7=CC=CC=C7)C8=CC=CC=C8)C(C4O)O)C9=CC=CC=C9)N3 |
Computed by PubChem (NCBI)