Products 850232-59-6
CAS 850232-59-6 is the registry number for Benzyl (S)-(1-(1H-benzo[d][1,2,3]triazol-1-yl)-3-(1H-indol-3-yl)-1-oxopropan-2-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl N-[(2S)-1-(benzotriazol-1-yl)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]carbamate (CAS 850232-59-6) is a chemical compound with the molecular formula C25H21N5O3 and a molecular weight of 439.5 g/mol. IUPAC name: benzyl N-[(2S)-1-(benzotriazol-1-yl)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]carbamate. InChIKey: OFKXDFXFJAJJHZ-QFIPXVFZSA-N.
| Molecular formula | C25H21N5O3 |
|---|---|
| Molecular weight | 439.5 g/mol |
| IUPAC name | benzyl N-[(2S)-1-(benzotriazol-1-yl)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]carbamate |
| InChIKey | OFKXDFXFJAJJHZ-QFIPXVFZSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CC2=CNC3=CC=CC=C32)C(=O)N4C5=CC=CC=C5N=N4 |
Computed by PubChem (NCBI)
Synonyms:
Z-Trp-Bt, Z-Trp-Bt, 95%