CAS 85026-60-4 is the registry number for 1,2-Di-O-acetyl-3,5-di-O-benzoyl-D-xylofuranose. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2R,3S,4R)-4,5-diacetyloxy-3-benzoyloxyoxolan-2-yl]methyl benzoate (CAS 85026-60-4) is a chemical compound with the molecular formula C23H22O9 and a molecular weight of 442.4 g/mol. IUPAC name: [(2R,3S,4R)-4,5-diacetyloxy-3-benzoyloxyoxolan-2-yl]methyl benzoate. InChIKey: IBBWABGIQGRNBK-MLJUJGDHSA-N.
| Molecular formula | C23H22O9 |
|---|---|
| Molecular weight | 442.4 g/mol |
| IUPAC name | [(2R,3S,4R)-4,5-diacetyloxy-3-benzoyloxyoxolan-2-yl]methyl benzoate |
| InChIKey | IBBWABGIQGRNBK-MLJUJGDHSA-N |
| SMILES | CC(=O)O[C@@H]1[C@H]([C@H](OC1OC(=O)C)COC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)