CAS 850349-84-7 is the registry number for 5-Bromo-2-(2,2,3,3,3-Pentafluoropropoxy)Pyridine. Offered by: Biosynth. Available pack sizes: 1g, 0,5g, 2g.
5-bromo-2-(2,2,3,3,3-pentafluoropropoxy)pyridine (CAS 850349-84-7) is a chemical compound with the molecular formula C8H5BrF5NO and a molecular weight of 306.03 g/mol. IUPAC name: 5-bromo-2-(2,2,3,3,3-pentafluoropropoxy)pyridine. InChIKey: MLANNPIADNEBIY-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF5NO |
|---|---|
| Molecular weight | 306.03 g/mol |
| IUPAC name | 5-bromo-2-(2,2,3,3,3-pentafluoropropoxy)pyridine |
| InChIKey | MLANNPIADNEBIY-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Br)OCC(C(F)(F)F)(F)F |
Computed by PubChem (NCBI)