CAS 850380-91-5 appears in our catalog under these names: 4-[4-(tert-Butyldimethylsilyloxy)phenyl]phenylboronic acid, 98%, (4'-((tert-Butyldimethylsilyl)oxy)-[1,1'-biphenyl]-4-yl)boronic acid 98%, 4-[4-(tert-Butyldimethylsilyloxy)phenyl]phenylboronic acid, 98%, 98%, (4'-((Tert-butyldimethylsilyl)oxy)-[1,1'-biphenyl]-4-yl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 25g.
[4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl]boronic acid (CAS 850380-91-5) is a chemical compound with the molecular formula C18H25BO3Si and a molecular weight of 328.3 g/mol. IUPAC name: [4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl]boronic acid. InChIKey: ZIKZPBVNZYGTDB-UHFFFAOYSA-N.
| Molecular formula | C18H25BO3Si |
|---|---|
| Molecular weight | 328.3 g/mol |
| IUPAC name | [4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl]boronic acid |
| InChIKey | ZIKZPBVNZYGTDB-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)O[Si](C)(C)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)