CAS 850421-06-6 is the registry number for N'-(3-Chloropyrazin-2-yl)-2,2,2-trifluoroacetohydrazide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg, 5g.
N'-(3-chloropyrazin-2-yl)-2,2,2-trifluoroacetohydrazide (CAS 850421-06-6) is a chemical compound with the molecular formula C6H4ClF3N4O and a molecular weight of 240.57 g/mol. IUPAC name: N'-(3-chloropyrazin-2-yl)-2,2,2-trifluoroacetohydrazide. InChIKey: DVTQQYPBIOJPAN-UHFFFAOYSA-N.
| Molecular formula | C6H4ClF3N4O |
|---|---|
| Molecular weight | 240.57 g/mol |
| IUPAC name | N'-(3-chloropyrazin-2-yl)-2,2,2-trifluoroacetohydrazide |
| InChIKey | DVTQQYPBIOJPAN-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=N1)NNC(=O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)