CAS 850429-52-6 is the registry number for 4-Bromo-N-[2-(TBDMSO)ethyl]benzenesulfonamide, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 500g, 100g, 25g.
4-bromo-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]benzenesulfonamide (CAS 850429-52-6) is a chemical compound with the molecular formula C14H24BrNO3SSi and a molecular weight of 394.40 g/mol. IUPAC name: 4-bromo-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]benzenesulfonamide. InChIKey: MDGPCUSYXKGALX-UHFFFAOYSA-N.
| Molecular formula | C14H24BrNO3SSi |
|---|---|
| Molecular weight | 394.40 g/mol |
| IUPAC name | 4-bromo-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]benzenesulfonamide |
| InChIKey | MDGPCUSYXKGALX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCCNS(=O)(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)