CAS 850429-53-7 is the registry number for 2,5-Dibromo-1-tritylimidazole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2,5-dibromo-1-tritylimidazole (CAS 850429-53-7) is a chemical compound with the molecular formula C22H16Br2N2 and a molecular weight of 468.2 g/mol. IUPAC name: 2,5-dibromo-1-tritylimidazole. InChIKey: GGUUMQXVXRVHTE-UHFFFAOYSA-N.
| Molecular formula | C22H16Br2N2 |
|---|---|
| Molecular weight | 468.2 g/mol |
| IUPAC name | 2,5-dibromo-1-tritylimidazole |
| InChIKey | GGUUMQXVXRVHTE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N4C(=CN=C4Br)Br |
Computed by PubChem (NCBI)