CAS 850462-65-6 appears in our catalog under these names: Methyl 2–(bromomethyl)–5–fluoro–3–nitrobenzoate, Methyl 2-(bromomethyl)-5-fluoro-3-nitrobenzoate 98%, BENZOIC ACID, 2-(BROMOMETHYL)-5-FLUORO-3-NITRO-, METHYL ESTER, 95%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 100mg, 50mg, 250mg, 1g.
Methyl 2-(bromomethyl)-5-fluoro-3-nitrobenzoate (CAS 850462-65-6) is a chemical compound with the molecular formula C9H7BrFNO4 and a molecular weight of 292.06 g/mol. IUPAC name: methyl 2-(bromomethyl)-5-fluoro-3-nitrobenzoate. InChIKey: QHOSCSXREWAFFC-UHFFFAOYSA-N.
| Molecular formula | C9H7BrFNO4 |
|---|---|
| Molecular weight | 292.06 g/mol |
| IUPAC name | methyl 2-(bromomethyl)-5-fluoro-3-nitrobenzoate |
| InChIKey | QHOSCSXREWAFFC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)F)[N+](=O)[O-])CBr |
Computed by PubChem (NCBI)