Products 85047-14-9
CAS 85047-14-9 appears in our catalog under these names: Rilmenidine-d4, Rilmenidine–d4. Offered by: Chemat Brand, GLPBio, MedChemExpress. Available pack sizes: on request, 1mg, 500μg, 5mg.
4,4,5,5-tetradeuterio-N-(dicyclopropylmethyl)-1,3-oxazol-2-amine (CAS 85047-14-9) is a chemical compound with the molecular formula C10H16N2O and a molecular weight of 184.27 g/mol. IUPAC name: 4,4,5,5-tetradeuterio-N-(dicyclopropylmethyl)-1,3-oxazol-2-amine. InChIKey: CQXADFVORZEARL-NZLXMSDQSA-N.
| Molecular formula | C10H16N2O |
|---|---|
| Molecular weight | 184.27 g/mol |
| IUPAC name | 4,4,5,5-tetradeuterio-N-(dicyclopropylmethyl)-1,3-oxazol-2-amine |
| InChIKey | CQXADFVORZEARL-NZLXMSDQSA-N |
| SMILES | [2H]C1(C(OC(=N1)NC(C2CC2)C3CC3)([2H])[2H])[2H] |
Computed by PubChem (NCBI)