CAS 850567-50-9 appears in our catalog under these names: 3-Amino-5-methoxycarbonylphenylboronic acid, pinacol ester hydrochloride, 97%, Methyl 3-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate hydrochloride, 97%, 3-Amino-5-methoxycarbonylphenylboronic acid, pinacol ester, HCl, 97%. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
Methyl 3-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate;hydrochloride (CAS 850567-50-9) is a chemical compound with the molecular formula C14H21BClNO4 and a molecular weight of 313.59 g/mol. IUPAC name: methyl 3-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate;hydrochloride. InChIKey: XFBMZLLETVIICU-UHFFFAOYSA-N.
| Molecular formula | C14H21BClNO4 |
|---|---|
| Molecular weight | 313.59 g/mol |
| IUPAC name | methyl 3-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate;hydrochloride |
| InChIKey | XFBMZLLETVIICU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)N)C(=O)OC.Cl |
Computed by PubChem (NCBI)