CAS 850567-58-7 is the registry number for 3-(4-Fluorophenyl)aminocarbonylphenylboronic acid, pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-(4-fluorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 850567-58-7) is a chemical compound with the molecular formula C19H21BFNO3 and a molecular weight of 341.2 g/mol. IUPAC name: N-(4-fluorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: SNPZVDHDRQNRNU-UHFFFAOYSA-N.
| Molecular formula | C19H21BFNO3 |
|---|---|
| Molecular weight | 341.2 g/mol |
| IUPAC name | N-(4-fluorophenyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | SNPZVDHDRQNRNU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(=O)NC3=CC=C(C=C3)F |
Computed by PubChem (NCBI)