CAS 850568-14-8 appears in our catalog under these names: [4-(tert-Butylcarbamoyl)phenyl]boronic acid, 98%, 98%, (4-(tert-Butylcarbamoyl)phenyl)boronic acid, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g.
[4-(tert-butylcarbamoyl)phenyl]boronic acid (CAS 850568-14-8) is a chemical compound with the molecular formula C11H16BNO3 and a molecular weight of 221.06 g/mol. IUPAC name: [4-(tert-butylcarbamoyl)phenyl]boronic acid. InChIKey: JAIIZPWLCVMPFA-UHFFFAOYSA-N.
| Molecular formula | C11H16BNO3 |
|---|---|
| Molecular weight | 221.06 g/mol |
| IUPAC name | [4-(tert-butylcarbamoyl)phenyl]boronic acid |
| InChIKey | JAIIZPWLCVMPFA-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NC(C)(C)C)(O)O |
Computed by PubChem (NCBI)