CAS 850568-37-5 appears in our catalog under these names: (3-Ethoxycarbonyl-5-nitrophenyl)boronic acid, 97%, (3-Ethoxycarbonyl-5-nitrophenyl)boronic acid, 98%, (3-Ethoxycarbonyl-5-nitrophenyl)boronic acid, 97%, 97%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 1g, 5g, 25g, 100g.
(3-ethoxycarbonyl-5-nitrophenyl)boronic acid (CAS 850568-37-5) is a chemical compound with the molecular formula C9H10BNO6 and a molecular weight of 238.99 g/mol. IUPAC name: (3-ethoxycarbonyl-5-nitrophenyl)boronic acid. InChIKey: JTIBFRZYCUDXOK-UHFFFAOYSA-N.
| Molecular formula | C9H10BNO6 |
|---|---|
| Molecular weight | 238.99 g/mol |
| IUPAC name | (3-ethoxycarbonyl-5-nitrophenyl)boronic acid |
| InChIKey | JTIBFRZYCUDXOK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)OCC)(O)O |
Computed by PubChem (NCBI)