CAS 850623-48-2 is the registry number for Potassium (3-methylthiophenyl)trifluoroborate, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 100g, 1g, 5g.
Potassium trifluoro-(3-methylsulfanylphenyl)boranuide (CAS 850623-48-2) is a chemical compound with the molecular formula C7H7BF3KS and a molecular weight of 230.10 g/mol. IUPAC name: potassium trifluoro-(3-methylsulfanylphenyl)boranuide. InChIKey: KYUGCBOZKRZMHW-UHFFFAOYSA-N.
| Molecular formula | C7H7BF3KS |
|---|---|
| Molecular weight | 230.10 g/mol |
| IUPAC name | potassium trifluoro-(3-methylsulfanylphenyl)boranuide |
| InChIKey | KYUGCBOZKRZMHW-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC(=CC=C1)SC)(F)(F)F.[K+] |
Computed by PubChem (NCBI)