CAS 850623-65-3 appears in our catalog under these names: Potassium trifluoro(2–(methylsulfonyl)phenyl)borate, Potassium trifluoro(2-(methylsulfonyl)phenyl)borate 98%. Offered by: GLPBio, Ambeed. Available pack sizes: 250mg, 1g, 5g.
Potassium trifluoro-(2-methylsulfonylphenyl)boranuide (CAS 850623-65-3) is a chemical compound with the molecular formula C7H7BF3KO2S and a molecular weight of 262.10 g/mol. IUPAC name: potassium trifluoro-(2-methylsulfonylphenyl)boranuide. InChIKey: XWXDHUNDHNZMGT-UHFFFAOYSA-N.
| Molecular formula | C7H7BF3KO2S |
|---|---|
| Molecular weight | 262.10 g/mol |
| IUPAC name | potassium trifluoro-(2-methylsulfonylphenyl)boranuide |
| InChIKey | XWXDHUNDHNZMGT-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC=CC=C1S(=O)(=O)C)(F)(F)F.[K+] |
Computed by PubChem (NCBI)